CAS No: 35233-72-8, Chemical Name: 5,11,13,15-tetramethyltricyclo[8.2.2.2~4,7~]hexadeca-1(12),4,6,10,13,15-hexaene
the physical and chemical property of 35233-72-8, 5,11,13,15-tetramethyltricyclo[8.2.2.2~4,7~]hexadeca-1(12),4,6,10,13,15-hexaene is provided by ChemNet.com
ChemNet > CAS > 35233-72-8 5,11,13,15-tetramethyltricyclo[8.2.2.2~4,7~]hexadeca-1(12),4,6,10,13,15-hexaene
35233-72-8 5,11,13,15-tetramethyltricyclo[8.2.2.2~4,7~]hexadeca-1(12),4,6,10,13,15-hexaene
| اسم المنتج |
5,11,13,15-tetramethyltricyclo[8.2.2.2~4,7~]hexadeca-1(12),4,6,10,13,15-hexaene |
| الاسم المستعار |
2,5,3',6'-Tetramethyl-(2.2)paracyclophane;
|
| الصيغة الجزيئية |
C20H24 |
| الوزن الجزيئي الغرامي |
264.4046 |
| InChI |
InChI=1/C20H24/c1-13-9-18-7-8-20-12-15(3)19(11-16(20)4)6-5-17(13)10-14(18)2/h9-12H,5-8H2,1-4H3 |
| إستراتيجية المساعدة القطرية |
35233-72-8 |
| بنية جزيئية |
![35233-72-8 5,11,13,15-tetramethyltricyclo[8.2.2.2~4,7~]hexadeca-1(12),4,6,10,13,15-hexaene](https://images-a.chemnet.com/suppliers/chembase/cas97/35233-72-8.png)
|
| كثافة |
0.991g/cm3 |
| نقطة الغليان |
385.6°C at 760 mmHg |
| معامل الإنكسار |
1.565 |
| نقطة الوميض |
204.3°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
